EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38O4 |
| Net Charge | 0 |
| Average Mass | 414.586 |
| Monoisotopic Mass | 414.27701 |
| SMILES | C/C=C(\C)C(O)C(C)/C=C(C)/C=C/CC(C)/C=C/c1oc(OC)c(CC)c(=O)c1C |
| InChI | InChI=1S/C26H38O4/c1-9-19(5)24(27)20(6)16-18(4)13-11-12-17(3)14-15-23-21(7)25(28)22(10-2)26(29-8)30-23/h9,11,13-17,20,24,27H,10,12H2,1-8H3/b13-11+,15-14+,18-16+,19-9+ |
| InChIKey | RZWLIPXWCCRKLN-PADIHOPFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces albus (ncbitaxon:1888) | mycelium (BTO:0001436) | PubMed (21718029) | Ethyl acetate extract of mycelial cake Strain: POR 04 15 053 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PM060054 (CHEBI:69899) has role metabolite (CHEBI:25212) |
| PM060054 (CHEBI:69899) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| 3-Ethyl-6-[(1E,5E,7E,11E)-10-hydroxy-3,7,9,11-tetramethyl-1,5,7,11-tridecatetraen-1-yl]-2-methoxy-5-methyl-4H-pyran-4-one | ChEBI |
| Citations |
|---|