EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36O4 |
| Net Charge | 0 |
| Average Mass | 400.559 |
| Monoisotopic Mass | 400.26136 |
| SMILES | C/C=C(\C)[C@H](O)[C@H](C)/C=C(C)/C=C/CC(C)/C=C/c1oc(OC)c(C)c(=O)c1C |
| InChI | InChI=1S/C25H36O4/c1-9-18(4)23(26)19(5)15-17(3)12-10-11-16(2)13-14-22-20(6)24(27)21(7)25(28-8)29-22/h9-10,12-16,19,23,26H,11H2,1-8H3/b12-10+,14-13+,17-15+,18-9+/t16?,19-,23+/m1/s1 |
| InChIKey | PIYNCLUPGLBENL-FJPKWDFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces albus (ncbitaxon:1888) | mycelium (BTO:0001436) | PubMed (21718029) | Ethyl acetate extract of mycelial cake Strain: POR 04 15 053 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PM050463 (CHEBI:69898) has role metabolite (CHEBI:25212) |
| PM050463 (CHEBI:69898) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| 2-[(1E,5E,7E,9R,10R,11E)-10-Hydroxy-3,7,9,11-tetramethyl-1,5,7,11-tridecatetraen-1-yl]-6-methoxy-3,5-dimethyl-4H-pyran-4-one | ChEBI |
| Citations |
|---|