EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O5 |
| Net Charge | 0 |
| Average Mass | 332.396 |
| Monoisotopic Mass | 332.16237 |
| SMILES | [H][C@@]12CC[C@H](C)[C@@]3(C)[C@H](OC(=O)C(C)C)c4c(C)coc4C(=O)[C@]31O2 |
| InChI | InChI=1S/C19H24O5/c1-9(2)17(21)23-16-13-10(3)8-22-14(13)15(20)19-12(24-19)7-6-11(4)18(16,19)5/h8-9,11-12,16H,6-7H2,1-5H3/t11-,12+,16+,18-,19-/m0/s1 |
| InChIKey | WNPQEVZAOIQRLM-MFLGIWNWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pittocaulon velatum (IPNI:238587-1) | |||
| stem (BTO:0001300) | PubMed (21661732) | Methanol extract of dried and ground stems and roots | |
| root (BTO:0001188) | PubMed (21661732) | Methanol extract of dried and ground stems and roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1aR,4S,4aS,5S,9aS)-4,4a,6-Trimethyl-9-oxo-2,3,4,4a,5,9-hexahydro-1aH-oxireno[8,8a]naphtho[2,3-b]furan-5-yl 2-methylpropanoate (CHEBI:69896) has role metabolite (CHEBI:25212) |
| (1aR,4S,4aS,5S,9aS)-4,4a,6-Trimethyl-9-oxo-2,3,4,4a,5,9-hexahydro-1aH-oxireno[8,8a]naphtho[2,3-b]furan-5-yl 2-methylpropanoate (CHEBI:69896) is a benzofurans (CHEBI:35259) |
| Citations |
|---|