EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29NO4 |
| Net Charge | 0 |
| Average Mass | 347.455 |
| Monoisotopic Mass | 347.20966 |
| SMILES | [H][C@@]12CCC[C@H](C)[C@@]1(C)[C@H](OC(=O)[C@](C)(N)CC)c1c(C)coc1C2=O |
| InChI | InChI=1S/C20H29NO4/c1-6-19(4,21)18(23)25-17-14-11(2)10-24-16(14)15(22)13-9-7-8-12(3)20(13,17)5/h10,12-13,17H,6-9,21H2,1-5H3/t12-,13-,17+,19+,20+/m0/s1 |
| InChIKey | CWFCNWIAOJWEMI-AIWDOVQNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pittocaulon velatum (IPNI:238587-1) | |||
| root (BTO:0001188) | PubMed (21661732) | Methanol extract of dried and ground stems and roots | |
| stem (BTO:0001300) | PubMed (21661732) | Methanol extract of dried and ground stems and roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-((4S,4aR,5S,8aR)-3,4a,5-trimethyl-9-oxo-4,4a,5,6,7,8,8a,9-octahydronaphtho[2,3-b]furan-4-yl) 2-amino-2-methylbutanoate (CHEBI:69895) has role metabolite (CHEBI:25212) |
| (R)-((4S,4aR,5S,8aR)-3,4a,5-trimethyl-9-oxo-4,4a,5,6,7,8,8a,9-octahydronaphtho[2,3-b]furan-4-yl) 2-amino-2-methylbutanoate (CHEBI:69895) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| (4S,4aR,5S,8aR)-3,4a,5-Trimethyl-9-oxo-4,4a,5,6,7,8,8a,9-octahydronaphtho[2,3-b]furan-4-yl L-isovalinate | ChEBI |
| Citations |
|---|