EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O8 |
| Net Charge | 0 |
| Average Mass | 412.479 |
| Monoisotopic Mass | 412.20972 |
| SMILES | C/C(=C\O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@@H]1C[C@@]2(C)C(=CC1=O)[C@H](O)CC[C@@H]2C |
| InChI | InChI=1S/C21H32O8/c1-10(9-28-20-19(27)18(26)17(25)16(8-22)29-20)12-7-21(3)11(2)4-5-14(23)13(21)6-15(12)24/h6,9,11-12,14,16-20,22-23,25-27H,4-5,7-8H2,1-3H3/b10-9+/t11-,12-,14+,16+,17+,18-,19+,20+,21+/m0/s1 |
| InChIKey | ZUXDAUFWFOCRLZ-LBZWAWMTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pittocaulon velatum (IPNI:238587-1) | |||
| stem (BTO:0001300) | PubMed (21661732) | Methanol extract of dried and ground stems and roots | |
| root (BTO:0001188) | PubMed (21661732) | Methanol extract of dried and ground stems and roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,4aR,5S,8R)-8-hydroxy-4a,5-dimethyl-3-((E)-1-((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yloxy)prop-1-en-2-yl)-4,4a,5,6,7,8-hexahydronaphthalen-2(3H)-one (CHEBI:69891) has role metabolite (CHEBI:25212) |
| (3S,4aR,5S,8R)-8-hydroxy-4a,5-dimethyl-3-((E)-1-((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yloxy)prop-1-en-2-yl)-4,4a,5,6,7,8-hexahydronaphthalen-2(3H)-one (CHEBI:69891) is a terpene glycoside (CHEBI:61777) |
| Citations |
|---|