EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O5 |
| Net Charge | 0 |
| Average Mass | 280.320 |
| Monoisotopic Mass | 280.13107 |
| SMILES | [H][C@@]12C[C@H](O)C[C@H](C)[C@@]1(C)[C@H](O)c1c(CO)coc1C2=O |
| InChI | InChI=1S/C15H20O5/c1-7-3-9(17)4-10-12(18)13-11(8(5-16)6-20-13)14(19)15(7,10)2/h6-7,9-10,14,16-17,19H,3-5H2,1-2H3/t7-,9+,10-,14+,15+/m0/s1 |
| InChIKey | LVMASFUXMANZSS-HTJAIIGDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pittocaulon velatum (IPNI:238587-1) | stem (BTO:0001300) | PubMed (21661732) | Methanol extract of dried and ground stems |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Velatumin (CHEBI:69889) has role metabolite (CHEBI:25212) |
| Velatumin (CHEBI:69889) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| (4S,4aR,5S,7R,8aR)-4,7-Dihydroxy-3-(hydroxymethyl)-4a,5-dimethyl-4a,5,6,7,8,8a-hexahydronaphtho[2,3-b]furan-9(4H)-one | ChEBI |
| Citations |
|---|