EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O4 |
| Net Charge | 0 |
| Average Mass | 264.321 |
| Monoisotopic Mass | 264.13616 |
| SMILES | [H][C@@]12CCC[C@H](C)[C@@]1(C)[C@H](C1=C(C)COC1=O)OC2=O |
| InChI | InChI=1S/C15H20O4/c1-8-7-18-14(17)11(8)12-15(3)9(2)5-4-6-10(15)13(16)19-12/h9-10,12H,4-7H2,1-3H3/t9-,10-,12-,15+/m0/s1 |
| InChIKey | LMDDBANVFKFESY-PCVQNBPASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pittocaulon velatum (IPNI:238587-1) | stem (BTO:0001300) | PubMed (21661732) | Methanol extract of dried and ground stems |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Velatumolide, (rel)- (CHEBI:69887) has role metabolite (CHEBI:25212) |
| Velatumolide, (rel)- (CHEBI:69887) is a γ-lactone (CHEBI:37581) |
| Synonym | Source |
|---|---|
| rel-(3R,3aR,4S,7aR)-3a,4-Dimethyl-3-(4-methyl-2-oxo-2,5-dihydro-3-furanyl)hexahydro-2-benzofuran-1(3H)-one | ChEBI |
| Citations |
|---|