EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38O7 |
| Net Charge | 0 |
| Average Mass | 474.594 |
| Monoisotopic Mass | 474.26175 |
| SMILES | [H][C@]12CCC[C@]3(CO3)[C@]1(COC(=O)/C(C)=C/C)[C@@H](OC(C)=O)C[C@@H](C)[C@]2(C)CCC1=CC(=O)OC1 |
| InChI | InChI=1S/C27H38O7/c1-6-17(2)24(30)32-16-27-21(8-7-10-26(27)15-33-26)25(5,11-9-20-13-23(29)31-14-20)18(3)12-22(27)34-19(4)28/h6,13,18,21-22H,7-12,14-16H2,1-5H3/b17-6+/t18-,21-,22+,25+,26+,27+/m1/s1 |
| InChIKey | TWZAPYCYRPQAOD-PIJHPVSDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ajuga ciliata (ncbitaxon:199542) | whole plant (BTO:0001461) | PubMed (21682262) | Methanol extract of air-dried whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ajugacumbin A (CHEBI:69880) has role plant metabolite (CHEBI:76924) |
| ajugacumbin A (CHEBI:69880) is a acetate ester (CHEBI:47622) |
| ajugacumbin A (CHEBI:69880) is a butenolide (CHEBI:50523) |
| ajugacumbin A (CHEBI:69880) is a diterpene lactone (CHEBI:49193) |
| ajugacumbin A (CHEBI:69880) is a enoate ester (CHEBI:51702) |
| ajugacumbin A (CHEBI:69880) is a spiro-epoxide (CHEBI:133131) |
| IUPAC Name |
|---|
| {(1R,4aR,5S,6R,8S,8aR)-8-(acetyloxy)-5,6-dimethyl-5-[2-(5-oxo-2,5-dihydrofuran-3-yl)ethyl]octahydro-8aH-spiro[naphthalene-1,2'-oxiran]-8a-yl}methyl (2E)-2-methylbut-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5661356 | Reaxys |
| Citations |
|---|