EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O11 |
| Net Charge | 0 |
| Average Mass | 390.341 |
| Monoisotopic Mass | 390.11621 |
| SMILES | [H][C@]12[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)OC=C(C(=O)O)[C@@]1([H])C=C[C@]2(O)CO |
| InChI | InChI=1S/C16H22O11/c17-3-8-10(19)11(20)12(21)15(26-8)27-14-9-6(1-2-16(9,24)5-18)7(4-25-14)13(22)23/h1-2,4,6,8-12,14-15,17-21,24H,3,5H2,(H,22,23)/t6-,8-,9-,10-,11+,12-,14+,15+,16+/m1/s1 |
| InChIKey | HPWWQPXTUDMRBI-NJPMDSMTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monotropein (CHEBI:6988) has role anti-inflammatory agent (CHEBI:67079) |
| monotropein (CHEBI:6988) has role metabolite (CHEBI:25212) |
| monotropein (CHEBI:6988) is a cyclopentapyran (CHEBI:38606) |
| monotropein (CHEBI:6988) is a iridoid monoterpenoid (CHEBI:50563) |
| monotropein (CHEBI:6988) is a monocarboxylic acid (CHEBI:25384) |
| monotropein (CHEBI:6988) is a monosaccharide derivative (CHEBI:63367) |
| monotropein (CHEBI:6988) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (1S,4aS,7R,7aS)-1-(β-D-glucopyranosyloxy)-7-hydroxy-7-(hydroxymethyl)-1,4a,7,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid |
| Synonym | Source |
|---|---|
| Monotropeine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00003089 | KNApSAcK |
| C09788 | KEGG COMPOUND |
| CN101817856 | Patent |
| LMPR0102070012 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:60559 | Reaxys |
| CAS:5945-50-6 | KEGG COMPOUND |
| CAS:5945-50-6 | ChemIDplus |
| Citations |
|---|