EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H42O11 |
| Net Charge | 0 |
| Average Mass | 590.666 |
| Monoisotopic Mass | 590.27271 |
| SMILES | [H][C@]12[C@H](OC(C)=O)CC[C@]3(CO3)[C@]1(COC(C)=O)[C@@H](OC(C)=O)C[C@@H](C)[C@]2(C)C[C@H](OC(=O)/C(C)=C/C)C1=CC(=O)OC1 |
| InChI | InChI=1S/C31H42O11/c1-8-17(2)28(36)42-24(22-12-26(35)37-14-22)13-29(7)18(3)11-25(41-21(6)34)31(16-38-19(4)32)27(29)23(40-20(5)33)9-10-30(31)15-39-30/h8,12,18,23-25,27H,9-11,13-16H2,1-7H3/b17-8+/t18-,23-,24+,25+,27-,29+,30+,31-/m1/s1 |
| InChIKey | SJNMHXILDVKBPL-BEEMTZEWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ajuga ciliata (ncbitaxon:199542) | whole plant (BTO:0001461) | PubMed (21682262) | Methanol extract of air-dried whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ajuganipponin A (CHEBI:69879) has role plant metabolite (CHEBI:76924) |
| ajuganipponin A (CHEBI:69879) is a acetate ester (CHEBI:47622) |
| ajuganipponin A (CHEBI:69879) is a butenolide (CHEBI:50523) |
| ajuganipponin A (CHEBI:69879) is a diterpene lactone (CHEBI:49193) |
| ajuganipponin A (CHEBI:69879) is a enoate ester (CHEBI:51702) |
| ajuganipponin A (CHEBI:69879) is a spiro-epoxide (CHEBI:133131) |
| IUPAC Name |
|---|
| (1S)-2-{(1R,4R,4aR,5S,6R,8S,8aR)-4,8-bis(acetyloxy)-8a-[(acetyloxy)methyl]-5,6-dimethyloctahydro-2H-spiro[naphthalene-1,2'-oxiran]-5-yl}-1-(5-oxo-2,5-dihydrofuran-3-yl)ethyl (2E)-2-methylbut-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21728543 | Reaxys |
| Citations |
|---|