EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40O10 |
| Net Charge | 0 |
| Average Mass | 548.629 |
| Monoisotopic Mass | 548.26215 |
| SMILES | [H][C@]12[C@H](OC(=O)/C(C)=C/C)CC[C@]3(CO3)[C@]1(COC(C)=O)[C@@H](OC(C)=O)C[C@@H](C)[C@]2(C)C[C@H](O)C1=CC(=O)OC1 |
| InChI | InChI=1S/C29H40O10/c1-7-16(2)26(34)39-22-8-9-28(14-37-28)29(15-36-18(4)30)23(38-19(5)31)10-17(3)27(6,25(22)29)12-21(32)20-11-24(33)35-13-20/h7,11,17,21-23,25,32H,8-10,12-15H2,1-6H3/b16-7+/t17-,21+,22-,23+,25-,27+,28+,29-/m1/s1 |
| InChIKey | HZPBAEMQRBYDPW-CJARLIFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ajuga ciliata (ncbitaxon:199542) | whole plant (BTO:0001461) | PubMed (21682262) | Methanol extract of air-dried whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ajugamarin A1 (CHEBI:69878) has role plant metabolite (CHEBI:76924) |
| ajugamarin A1 (CHEBI:69878) is a acetate ester (CHEBI:47622) |
| ajugamarin A1 (CHEBI:69878) is a butenolide (CHEBI:50523) |
| ajugamarin A1 (CHEBI:69878) is a diterpene lactone (CHEBI:49193) |
| ajugamarin A1 (CHEBI:69878) is a spiro-epoxide (CHEBI:133131) |
| IUPAC Name |
|---|
| (1R,4R,4aR,5S,6R,8S,8aR)-8-(acetyloxy)-8a-[(acetyloxy)methyl]-5-[(2S)-2-hydroxy-2-(5-oxo-2,5-dihydrofuran-3-yl)ethyl]-5,6-dimethyloctahydro-2H-spiro[naphthalene-1,2'-oxiran]-4-yl (2E)-2-methylbut-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5786632 | Reaxys |
| Citations |
|---|