EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48O11 |
| Net Charge | 0 |
| Average Mass | 632.747 |
| Monoisotopic Mass | 632.31966 |
| SMILES | [H][C@]12[C@H](OC(=O)/C(C)=C/C)CC[C@]3(CO3)[C@]1(COC(C)=O)[C@@H](OC(C)=O)C[C@@H](C)[C@]2(C)C[C@H](OC(=O)[C@@H](C)CC)C1=CC(=O)OC1 |
| InChI | InChI=1S/C34H48O11/c1-9-19(3)30(38)44-25-11-12-33(17-42-33)34(18-41-22(6)35)27(43-23(7)36)13-21(5)32(8,29(25)34)15-26(24-14-28(37)40-16-24)45-31(39)20(4)10-2/h9,14,20-21,25-27,29H,10-13,15-18H2,1-8H3/b19-9+/t20-,21+,25+,26-,27-,29+,32-,33-,34+/m0/s1 |
| InChIKey | JTNPKPFJZRMAJE-FKSBINAYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ajuga ciliata (ncbitaxon:199542) | whole plant (BTO:0001461) | PubMed (21682262) | Methanol extract of air-dried whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ajugamarin G1 (CHEBI:69877) has role plant metabolite (CHEBI:76924) |
| ajugamarin G1 (CHEBI:69877) is a acetate ester (CHEBI:47622) |
| ajugamarin G1 (CHEBI:69877) is a butenolide (CHEBI:50523) |
| ajugamarin G1 (CHEBI:69877) is a diterpene lactone (CHEBI:49193) |
| ajugamarin G1 (CHEBI:69877) is a spiro-epoxide (CHEBI:133131) |
| IUPAC Name |
|---|
| (1R,4R,4aR,5S,6R,8S,8aR)-8-(acetyloxy)-8a-[(acetyloxy)methyl]-5,6-dimethyl-5-[(2S)-2-{[(2S)-2-methylbutanoyl]oxy}-2-(5-oxo-2,5-dihydrofuran-3-yl)ethyl]octahydro-2H-spiro[naphthalene-1,2'-oxiran]-4-yl (2E)-2-methylbut-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6035938 | Reaxys |
| CAS:122587-83-1 | ChemIDplus |
| Citations |
|---|