EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O7 |
| Net Charge | 0 |
| Average Mass | 450.572 |
| Monoisotopic Mass | 450.26175 |
| SMILES | [H][C@]12CCC[C@](O)(CO)[C@]1(COC(=O)/C(C)=C/C)[C@@H](O)C[C@@H](C)[C@]2(C)CCC1=CC(=O)OC1 |
| InChI | InChI=1S/C25H38O7/c1-5-16(2)22(29)32-15-25-19(7-6-9-24(25,30)14-26)23(4,17(3)11-20(25)27)10-8-18-12-21(28)31-13-18/h5,12,17,19-20,26-27,30H,6-11,13-15H2,1-4H3/b16-5+/t17-,19-,20+,23+,24+,25+/m1/s1 |
| InChIKey | MIOANCGOVTTWSH-DONKYKGPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ajuga ciliata (ncbitaxon:199542) | whole plant (BTO:0001461) | PubMed (21682262) | Methanol extract of air-dried whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ajugacumbin F (CHEBI:69873) has role plant metabolite (CHEBI:76924) |
| ajugacumbin F (CHEBI:69873) is a butenolide (CHEBI:50523) |
| ajugacumbin F (CHEBI:69873) is a carbobicyclic compound (CHEBI:36785) |
| ajugacumbin F (CHEBI:69873) is a diterpene lactone (CHEBI:49193) |
| ajugacumbin F (CHEBI:69873) is a enoate ester (CHEBI:51702) |
| ajugacumbin F (CHEBI:69873) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| [(1S,2R,4S,4aR,5R,8aR)-4,5-dihydroxy-5-(hydroxymethyl)-1,2-dimethyl-1-[2-(5-oxo-2,5-dihydrofuran-3-yl)ethyl]octahydronaphthalen-4a(2H)-yl]methyl (2E)-2-methylbut-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4336646 | Reaxys |
| Citations |
|---|