EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O8 |
| Net Charge | 0 |
| Average Mass | 492.609 |
| Monoisotopic Mass | 492.27232 |
| SMILES | [H][C@]12CCC[C@](O)(COC(C)=O)[C@]1(COC(=O)/C(C)=C/C)[C@@H](O)C[C@@H](C)[C@]2(C)CCC1=CC(=O)OC1 |
| InChI | InChI=1S/C27H40O8/c1-6-17(2)24(31)35-16-27-21(8-7-10-26(27,32)15-34-19(4)28)25(5,18(3)12-22(27)29)11-9-20-13-23(30)33-14-20/h6,13,18,21-22,29,32H,7-12,14-16H2,1-5H3/b17-6+/t18-,21-,22+,25+,26+,27+/m1/s1 |
| InChIKey | AMVXZRRATHTNNC-PIJHPVSDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ajuga ciliata (ncbitaxon:199542) | whole plant (BTO:0001461) | PubMed (21682262) | Methanol extract of air-dried whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ajugaciliatin I (CHEBI:69870) has functional parent tiglic acid (CHEBI:9592) |
| ajugaciliatin I (CHEBI:69870) has role plant metabolite (CHEBI:76924) |
| ajugaciliatin I (CHEBI:69870) is a acetate ester (CHEBI:47622) |
| ajugaciliatin I (CHEBI:69870) is a butenolide (CHEBI:50523) |
| ajugaciliatin I (CHEBI:69870) is a carbobicyclic compound (CHEBI:36785) |
| ajugaciliatin I (CHEBI:69870) is a diol (CHEBI:23824) |
| ajugaciliatin I (CHEBI:69870) is a diterpene lactone (CHEBI:49193) |
| ajugaciliatin I (CHEBI:69870) is a enoate ester (CHEBI:51702) |
| IUPAC Name |
|---|
| [(1S,2R,4S,4aR,5R,8aR)-5-[(acetyloxy)methyl]-4,5-dihydroxy-1,2-dimethyl-1-[2-(5-oxo-2,5-dihydrofuran-3-yl)ethyl]octahydronaphthalen-4a(2H)-yl]methyl (2E)-2-methylbut-2-enoate |
| Synonym | Source |
|---|---|
| 18-acetoxy-4α,6α-dihydroxy-19-tigloyloxy-neo-clerod-13-en-15,16-olide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21728541 | Reaxys |
| Citations |
|---|