EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H43ClO11 |
| Net Charge | 0 |
| Average Mass | 627.127 |
| Monoisotopic Mass | 626.24939 |
| SMILES | [H][C@]12[C@H](OC(=O)/C(C)=C/C)CC[C@](O)(CCl)[C@]1(COC(C)=O)[C@@H](OC(C)=O)C[C@@H](C)[C@]2(C)C[C@H](OC(C)=O)C1=CC(=O)OC1 |
| InChI | InChI=1S/C31H43ClO11/c1-8-17(2)28(37)43-23-9-10-30(38,15-32)31(16-40-19(4)33)25(42-21(6)35)11-18(3)29(7,27(23)31)13-24(41-20(5)34)22-12-26(36)39-14-22/h8,12,18,23-25,27,38H,9-11,13-16H2,1-7H3/b17-8+/t18-,23-,24+,25+,27-,29+,30+,31-/m1/s1 |
| InChIKey | MQMQEPSKXRDQHX-BEEMTZEWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ajuga ciliata (ncbitaxon:199542) | whole plant (BTO:0001461) | PubMed (21682262) | Methanol extract of air-dried whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ajugamarin A2 chlorohydrin (CHEBI:69865) has functional parent tiglic acid (CHEBI:9592) |
| ajugamarin A2 chlorohydrin (CHEBI:69865) has role neuroprotective agent (CHEBI:63726) |
| ajugamarin A2 chlorohydrin (CHEBI:69865) has role plant metabolite (CHEBI:76924) |
| ajugamarin A2 chlorohydrin (CHEBI:69865) is a acetate ester (CHEBI:47622) |
| ajugamarin A2 chlorohydrin (CHEBI:69865) is a butenolide (CHEBI:50523) |
| ajugamarin A2 chlorohydrin (CHEBI:69865) is a carbobicyclic compound (CHEBI:36785) |
| ajugamarin A2 chlorohydrin (CHEBI:69865) is a diterpene lactone (CHEBI:49193) |
| ajugamarin A2 chlorohydrin (CHEBI:69865) is a organochlorine compound (CHEBI:36683) |
| ajugamarin A2 chlorohydrin (CHEBI:69865) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1R,4R,4aR,5S,7R,8S,8aR)-5-(acetyloxy)-4a-[(acetyloxy)methyl]-8-[(2S)-2-(acetyloxy)-2-(5-oxo-2,5-dihydrofuran-3-yl)ethyl]-4-(chloromethyl)-4-hydroxy-7,8-dimethyldecahydronaphthalen-1-yl (2E)-2-methylbut-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:26277984 | Reaxys |
| Citations |
|---|