EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H47ClO11 |
| Net Charge | 0 |
| Average Mass | 667.192 |
| Monoisotopic Mass | 666.28069 |
| SMILES | [H][C@]12[C@H](OC(=O)/C(C)=C/C)CC[C@](O)(CCl)[C@]1(COC(C)=O)[C@@H](OC(C)=O)C[C@@H](C)[C@]2(C)C[C@H](OC(=O)/C(C)=C/C)C1=CC(=O)OC1 |
| InChI | InChI=1S/C34H47ClO11/c1-9-19(3)30(39)45-25-11-12-33(41,17-35)34(18-43-22(6)36)27(44-23(7)37)13-21(5)32(8,29(25)34)15-26(24-14-28(38)42-16-24)46-31(40)20(4)10-2/h9-10,14,21,25-27,29,41H,11-13,15-18H2,1-8H3/b19-9+,20-10+/t21-,25-,26+,27+,29-,32+,33+,34-/m1/s1 |
| InChIKey | RNFBKZKYPCIMDW-NFWHYXGOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ajuga ciliata (ncbitaxon:199542) | whole plant (BTO:0001461) | PubMed (21682262) | Methanol extract of air-dried whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ajugaciliatin E (CHEBI:69864) has functional parent tiglic acid (CHEBI:9592) |
| ajugaciliatin E (CHEBI:69864) has role plant metabolite (CHEBI:76924) |
| ajugaciliatin E (CHEBI:69864) is a acetate ester (CHEBI:47622) |
| ajugaciliatin E (CHEBI:69864) is a butenolide (CHEBI:50523) |
| ajugaciliatin E (CHEBI:69864) is a carbobicyclic compound (CHEBI:36785) |
| ajugaciliatin E (CHEBI:69864) is a diterpene lactone (CHEBI:49193) |
| ajugaciliatin E (CHEBI:69864) is a organochlorine compound (CHEBI:36683) |
| ajugaciliatin E (CHEBI:69864) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1S)-2-[(1S,2R,4S,4aR,5R,8R,8aR)-4-(acetyloxy)-4a-[(acetyloxy)methyl]-5-(chloromethyl)-5-hydroxy-1,2-dimethyl-8-{[(2E)-2-methylbut-2-enoyl]oxy}decahydronaphthalen-1-yl]-1-(5-oxo-2,5-dihydrofuran-3-yl)ethyl (2E)-2-methylbut-2-enoate |
| Synonym | Source |
|---|---|
| (12S)-6α,19-diacetoxy-18-chloro-4α-hydroxy-1β,12-ditigloyloxy-neo-clerod-13-en-15,16-olide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21728547 | Reaxys |
| Citations |
|---|