EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H45ClO11 |
| Net Charge | 0 |
| Average Mass | 629.143 |
| Monoisotopic Mass | 628.26504 |
| SMILES | [H][C@]12[C@H](OC(C)=O)CC[C@](O)(CCl)[C@]1(COC(C)=O)[C@@H](OC(C)=O)C[C@@H](C)[C@]2(C)C[C@H](OC(=O)[C@@H](C)CC)C1=CC(=O)OC1 |
| InChI | InChI=1S/C31H45ClO11/c1-8-17(2)28(37)43-24(22-12-26(36)39-14-22)13-29(7)18(3)11-25(42-21(6)35)31(16-40-19(4)33)27(29)23(41-20(5)34)9-10-30(31,38)15-32/h12,17-18,23-25,27,38H,8-11,13-16H2,1-7H3/t17-,18+,23+,24-,25-,27+,29-,30-,31+/m0/s1 |
| InChIKey | LMCZPZLFURXAIA-JKZOSZDYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ajuga ciliata (ncbitaxon:199542) | whole plant (BTO:0001461) | PubMed (21682262) | Methanol extract of air-dried whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ajugaciliatin B (CHEBI:69861) has role neuroprotective agent (CHEBI:63726) |
| ajugaciliatin B (CHEBI:69861) has role plant metabolite (CHEBI:76924) |
| ajugaciliatin B (CHEBI:69861) is a acetate ester (CHEBI:47622) |
| ajugaciliatin B (CHEBI:69861) is a butenolide (CHEBI:50523) |
| ajugaciliatin B (CHEBI:69861) is a carbobicyclic compound (CHEBI:36785) |
| ajugaciliatin B (CHEBI:69861) is a diterpene lactone (CHEBI:49193) |
| ajugaciliatin B (CHEBI:69861) is a organochlorine compound (CHEBI:36683) |
| ajugaciliatin B (CHEBI:69861) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1S)-2-[(1S,2R,4S,4aR,5R,8R,8aR)-4,8-bis(acetyloxy)-4a-[(acetyloxy)methyl]-5-(chloromethyl)-5-hydroxy-1,2-dimethyldecahydronaphthalen-1-yl]-1-(5-oxo-2,5-dihydrofuran-3-yl)ethyl (2S)-2-methylbutanoate |
| Synonym | Source |
|---|---|
| (12S,2'''S)-1β,6α,19-triacetoxy-18-chloro-4α-hydroxy-12-(2-methylbutanoyloxy)-neo-clerod-13-en-15,16-olide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21728544 | Reaxys |
| Citations |
|---|