EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H38O6 |
| Net Charge | 0 |
| Average Mass | 386.529 |
| Monoisotopic Mass | 386.26684 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CO[C@@H]([C@H](O)[C@H](O)CO)[C@H](O)CO |
| InChI | InChI=1S/C21H38O6/c1-15(2)7-5-8-16(3)9-6-10-17(4)11-12-27-21(19(25)14-23)20(26)18(24)13-22/h7,9,11,18-26H,5-6,8,10,12-14H2,1-4H3/b16-9+,17-11+/t18-,19-,20-,21-/m1/s1 |
| InChIKey | ZUIFOWRAXRUUGS-WOXVAYPUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cosmospora joca (fungorum:460234) | - | PubMed (21682264) | Ethyl acetate extract of fermented broth. Strain: 89041201 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cosmosporaside A (CHEBI:69855) has role metabolite (CHEBI:25212) |
| Cosmosporaside A (CHEBI:69855) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| 3-O-[(2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrien-1-yl]-D-mannitol | ChEBI |
| Citations |
|---|