EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O5 |
| Net Charge | 0 |
| Average Mass | 450.660 |
| Monoisotopic Mass | 450.33452 |
| SMILES | [H][C@]1([C@H](C)[C@H](O)CC[C@@H](C)CO)[C@@H](O)C[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])[C@H](O)C[C@]12C |
| InChI | InChI=1S/C27H46O5/c1-15(14-28)5-8-21(30)16(2)24-22(31)12-20-19-7-6-17-11-18(29)9-10-26(17,3)25(19)23(32)13-27(20,24)4/h6,15-16,18-25,28-32H,5,7-14H2,1-4H3/t15-,16-,18+,19+,20+,21-,22+,23-,24+,25-,26+,27+/m1/s1 |
| InChIKey | SJLLAOHWHAIKHM-ACCDBCDYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chamaelirium luteum (ncbitaxon:112831) | root (BTO:0001188) | PubMed (21692443) | 80% methanol extract of powdered roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Helogenin (CHEBI:69854) has role metabolite (CHEBI:25212) |
| Helogenin (CHEBI:69854) is a steroid (CHEBI:35341) |
| Citations |
|---|