EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O8 |
| Net Charge | 0 |
| Average Mass | 386.441 |
| Monoisotopic Mass | 386.19407 |
| SMILES | CC(=O)C=C=C1C(C)(C)C[C@H](O)C[C@@]1(C)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H30O8/c1-10(21)5-6-13-18(2,3)7-11(22)8-19(13,4)27-17-16(25)15(24)14(23)12(9-20)26-17/h5,11-12,14-17,20,22-25H,7-9H2,1-4H3/t6?,11-,12+,14+,15-,16+,17-,19+/m0/s1 |
| InChIKey | XTODSGVDHGMKSN-SIEIHWOKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sanicula lamelligera (ncbitaxon:84533) | whole plant (BTO:0001461) | PubMed (21561060) | 80% aqueous ethanolic extract of dried, powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citroside B (CHEBI:69850) has role metabolite (CHEBI:25212) |
| citroside B (CHEBI:69850) is a allenes (CHEBI:37602) |
| citroside B (CHEBI:69850) is a terpene glycoside (CHEBI:61777) |
| Synonym | Source |
|---|---|
| (1R,5S)-5-Hydroxy-1,3,3-trimethyl-2-(3-oxo-1-buten-1-ylidene)cyclohexyl beta-D-glucopyranoside | ChEBI |
| Citations |
|---|