EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O2 |
| Net Charge | 0 |
| Average Mass | 238.371 |
| Monoisotopic Mass | 238.19328 |
| SMILES | [H][C@@]12C[C@H](C(=C)C)CC[C@@]1(C)[C@H](O)CC[C@@]2(C)O |
| InChI | InChI=1S/C15H26O2/c1-10(2)11-5-7-14(3)12(9-11)15(4,17)8-6-13(14)16/h11-13,16-17H,1,5-9H2,2-4H3/t11-,12-,13-,14-,15-/m1/s1 |
| InChIKey | LGKGTMWCBFNQHP-KJWHEZOQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sanicula lamelligera (ncbitaxon:84533) | whole plant (BTO:0001461) | PubMed (21561060) | 80% aqueous ethanolic extract of dried, powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyperusol C (CHEBI:69847) has role metabolite (CHEBI:25212) |
| cyperusol C (CHEBI:69847) is a eudesmane sesquiterpenoid (CHEBI:62508) |
| Synonym | Source |
|---|---|
| (1R,4R,4aR,7R,8aR)-7-Isopropenyl-1,4a-dimethyldecahydro-1,4-naphthalenediol | ChEBI |
| Citations |
|---|