EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22O2 |
| Net Charge | 0 |
| Average Mass | 222.328 |
| Monoisotopic Mass | 222.16198 |
| SMILES | [H][C@]12CCC(=O)[C@@]1([H])[C@]2([H])[C@@H](CCC(C)=O)C(C)C |
| InChI | InChI=1S/C14H22O2/c1-8(2)10(5-4-9(3)15)13-11-6-7-12(16)14(11)13/h8,10-11,13-14H,4-7H2,1-3H3/t10-,11+,13+,14-/m0/s1 |
| InChIKey | GDQRIBRXZMXMRL-UNJBNNCHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sanicula lamelligera (ncbitaxon:84533) | whole plant (BTO:0001461) | PubMed (21561060) | 80% aqueous ethanolic extract of dried, powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Saniculamoid D (CHEBI:69843) has role metabolite (CHEBI:25212) |
| Saniculamoid D (CHEBI:69843) is a cyclohexanones (CHEBI:23482) |
| Synonym | Source |
|---|---|
| (1R,5R,6R)-6-[(3S)-2-Methyl-6-oxo-3-heptanyl]bicyclo[3.1.0]hexan-2-one | ChEBI |
| Citations |
|---|