EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O4 |
| Net Charge | 0 |
| Average Mass | 272.385 |
| Monoisotopic Mass | 272.19876 |
| SMILES | [H][C@]12C[C@H](C(C)(C)O)[C@@H](O)C[C@@](C)(O)[C@@]1([H])CC[C@@]2(C)O |
| InChI | InChI=1S/C15H28O4/c1-13(2,17)11-7-10-9(5-6-14(10,3)18)15(4,19)8-12(11)16/h9-12,16-19H,5-8H2,1-4H3/t9-,10-,11-,12-,14+,15+/m0/s1 |
| InChIKey | HASSBFRDJUITDM-OOAGNDBOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sanicula lamelligera (ncbitaxon:84533) | whole plant (BTO:0001461) | PubMed (21561060) | 80% aqueous ethanolic extract of dried, powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Saniculamoid C (CHEBI:69842) has role metabolite (CHEBI:25212) |
| Saniculamoid C (CHEBI:69842) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| (1R,3aS,4R,6S,7S,8aS)-7-(2-Hydroxy-2-propanyl)-1,4-dimethyldecahydro-1,4,6-azulenetriol | ChEBI |
| Citations |
|---|