EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O3 |
| Net Charge | 0 |
| Average Mass | 254.370 |
| Monoisotopic Mass | 254.18819 |
| SMILES | [H][C@@]12O[C@]1(CO)CC[C@H](O)[C@@]1(C)CC[C@H](C(C)C)[C@@]21[H] |
| InChI | InChI=1S/C15H26O3/c1-9(2)10-4-6-14(3)11(17)5-7-15(8-16)13(18-15)12(10)14/h9-13,16-17H,4-8H2,1-3H3/t10-,11+,12+,13+,14-,15+/m1/s1 |
| InChIKey | WAYKLJZCQJLECB-DBWOOVFOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sanicula lamelligera (ncbitaxon:84533) | whole plant (BTO:0001461) | PubMed (21561060) | 80% aqueous ethanolic extract of dried, powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Saniculamoid B (CHEBI:69841) has role metabolite (CHEBI:25212) |
| Saniculamoid B (CHEBI:69841) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| (1aS,4S,4aS,7R,7aR,7bS)-1a-(Hydroxymethyl)-7-isopropyl-4a-methyldecahydroazuleno[4,5-b]oxiren-4-ol | ChEBI |
| Citations |
|---|