EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21Br2N5O4 |
| Net Charge | 0 |
| Average Mass | 495.172 |
| Monoisotopic Mass | 492.99603 |
| SMILES | COC1=C(Br)[C@H](O)[C@@]2(C=C1Br)CC(C(=O)NCCCCNC(=N)N)=NO2 |
| InChI | InChI=1S/C15H21Br2N5O4/c1-25-11-8(16)6-15(12(23)10(11)17)7-9(22-26-15)13(24)20-4-2-3-5-21-14(18)19/h6,12,23H,2-5,7H2,1H3,(H,20,24)(H4,18,19,21)/t12-,15+/m0/s1 |
| InChIKey | VJEGSWJGTALRBW-SWLSCSKDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Suberea mollis (WORMS:169627) | - | PubMed (21542602) | EtOH extract of frozen sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| purealidin L (CHEBI:69839) has role metabolite (CHEBI:25212) |
| purealidin L (CHEBI:69839) is a isoxazoles (CHEBI:55373) |
| Synonyms | Source |
|---|---|
| (5S,10R)-7,9-Dibromo-N-{4-[(diaminomethylene)amino]butyl}-10-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,6,8-triene-3-carboxamide | ChEBI |
| purealidine L | ChEBI |
| Citations |
|---|