EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26Br4N4O8 |
| Net Charge | 0 |
| Average Mass | 818.108 |
| Monoisotopic Mass | 813.84841 |
| SMILES | COC1=C(Br)[C@H](O)[C@@]2(C=C1Br)CC(C(=O)NCCCCNC(=O)C1=NO[C@]3(C=C(Br)C(OC)=C(Br)[C@@H]3O)C1)=NO2 |
| InChI | InChI=1S/C24H26Br4N4O8/c1-37-17-11(25)7-23(19(33)15(17)27)9-13(31-39-23)21(35)29-5-3-4-6-30-22(36)14-10-24(40-32-14)8-12(26)18(38-2)16(28)20(24)34/h7-8,19-20,33-34H,3-6,9-10H2,1-2H3,(H,29,35)(H,30,36)/t19-,20-,23+,24+/m0/s1 |
| InChIKey | BJWQSQOWGBUSFC-UWXQAFAOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Suberea mollis (WORMS:169627) | - | PubMed (21542602) | EtOH extract of frozen sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aerothionin (CHEBI:69838) has role metabolite (CHEBI:25212) |
| aerothionin (CHEBI:69838) is a isoxazoles (CHEBI:55373) |
| Synonym | Source |
|---|---|
| (5S,10R,5'S,10'R)-N,N'-butane-1,4-diylbis(7,9-dibromo-10-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,6,8-triene-3-carboxamide) | ChEBI |
| Citations |
|---|