EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7Cl2NO3 |
| Net Charge | 0 |
| Average Mass | 236.054 |
| Monoisotopic Mass | 234.98030 |
| SMILES | NC(=O)CC1(O)C=C(Cl)C(=O)C(Cl)=C1 |
| InChI | InChI=1S/C8H7Cl2NO3/c9-4-1-8(14,3-6(11)12)2-5(10)7(4)13/h1-2,14H,3H2,(H2,11,12) |
| InChIKey | JYWPCJDFYIJMEM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Suberea mollis (WORMS:169627) | - | PubMed (21542602) | EtOH extract of frozen sponge |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dichloroverongiaquinol (CHEBI:69837) has role metabolite (CHEBI:25212) |
| dichloroverongiaquinol (CHEBI:69837) is a amino alcohol (CHEBI:22478) |
| Manual Xrefs | Databases |
|---|---|
| 10469941 | ChemSpider |
| Citations |
|---|