EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10BrNO3 |
| Net Charge | 0 |
| Average Mass | 260.087 |
| Monoisotopic Mass | 258.98441 |
| SMILES | COc1ccc(O)c(CC(N)=O)c1Br |
| InChI | InChI=1S/C9H10BrNO3/c1-14-7-3-2-6(12)5(9(7)10)4-8(11)13/h2-3,12H,4H2,1H3,(H2,11,13) |
| InChIKey | MPLYVLNQUBGCNX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Suberea mollis (WORMS:169627) | - | PubMed (21542602) | EtOH extract of frozen sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| subereaphenol D (CHEBI:69836) has role metabolite (CHEBI:25212) |
| subereaphenol D (CHEBI:69836) is a methoxybenzenes (CHEBI:51683) |
| subereaphenol D (CHEBI:69836) is a phenols (CHEBI:33853) |
| Synonym | Source |
|---|---|
| 2-(2-bromo-6-hydroxy-3-methoxyphenyl)acetamide | ChEBI |
| Citations |
|---|