EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20Br2N4O4 |
| Net Charge | 0 |
| Average Mass | 492.168 |
| Monoisotopic Mass | 489.98513 |
| SMILES | COc1c(Br)cc(/C=C/C(=O)N[C@H](CCCNC(=N)N)C(=O)O)cc1Br |
| InChI | InChI=1S/C16H20Br2N4O4/c1-26-14-10(17)7-9(8-11(14)18)4-5-13(23)22-12(15(24)25)3-2-6-21-16(19)20/h4-5,7-8,12H,2-3,6H2,1H3,(H,22,23)(H,24,25)(H4,19,20,21)/b5-4+/t12-/m1/s1 |
| InChIKey | GKHMZHGZTZCUKR-ZYOFXKKJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Suberea mollis (WORMS:169627) | - | PubMed (21542602) | EtOH extract of frozen sponge |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| subereamine B (CHEBI:69835) has role metabolite (CHEBI:25212) |
| subereamine B (CHEBI:69835) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| (E)-2-(3-(3,5-dibromo-4-methoxyphenyl)acrylamido)-5-guanidinopentanoic acid | ChEBI |
| N2-[(2E)-3-(3,5-Dibromo-4-methoxyphenyl)-2-propenoyl]-D-arginine | ChEBI |
| Citations |
|---|