EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21BrN4O4 |
| Net Charge | 0 |
| Average Mass | 413.272 |
| Monoisotopic Mass | 412.07462 |
| SMILES | COc1ccc(/C=C/C(=O)N[C@H](CCCNC(=N)N)C(=O)O)cc1Br |
| InChI | InChI=1S/C16H21BrN4O4/c1-25-13-6-4-10(9-11(13)17)5-7-14(22)21-12(15(23)24)3-2-8-20-16(18)19/h4-7,9,12H,2-3,8H2,1H3,(H,21,22)(H,23,24)(H4,18,19,20)/b7-5+/t12-/m1/s1 |
| InChIKey | CYWJABQUHPIUCD-HOSRBBHYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Suberea mollis (WORMS:169627) | - | PubMed (21542602) | EtOH extract of frozen sponge |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| subereamine A (CHEBI:69834) has role metabolite (CHEBI:25212) |
| subereamine A (CHEBI:69834) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| (E)-2-(3-(3-bromo-4-methoxyphenyl)acrylamido)-5-guanidinopentanoic acid | ChEBI |
| N2-[(2E)-3-(3-Bromo-4-methoxyphenyl)-2-propenoyl]-D-arginine | ChEBI |
| Citations |
|---|