EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O3 |
| Net Charge | 0 |
| Average Mass | 298.382 |
| Monoisotopic Mass | 298.15689 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1cc2ccc(=O)oc2cc1O |
| InChI | InChI=1S/C19H22O3/c1-13(2)5-4-6-14(3)7-8-15-11-16-9-10-19(21)22-18(16)12-17(15)20/h5,7,9-12,20H,4,6,8H2,1-3H3/b14-7+ |
| InChIKey | INBMTJJPUABOQJ-VGOFMYFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Peucedanum ostruthium (ncbitaxon:1000424) | |||
| root (BTO:0001188) | PubMed (21627108) | Dichloromethane extract of dried, powdered roots and rhizomes | |
| rhizome (BTO:0001181) | PubMed (21627108) | Dichloromethane extract of dried, powdered roots and rhizomes |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ostruthin (CHEBI:69833) has role metabolite (CHEBI:25212) |
| Ostruthin (CHEBI:69833) is a terpene lactone (CHEBI:37668) |
| Synonyms | Source |
|---|---|
| 2H-1-Benzopyran-2-one, 6-(3,7-dimethyl-2,6-octadienyl)-7-hydroxy-, (E)- | ChEBI |
| 6-(3,7-Dimethyl-2,6-octadienyl)-7-hydroxycoumarin | ChEBI |
| 6-Geranyl-7-hydroxycoumarin | ChEBI |
| Ostruthin | KEGG COMPOUND |
| Citations |
|---|