EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:69832 - osthole
| Formula | C15H16O3 |
| Net Charge | 0 |
| Average Mass | 244.290 |
| Monoisotopic Mass | 244.10994 |
| SMILES | COc1ccc2ccc(=O)oc2c1CC=C(C)C |
| InChI | InChI=1S/C15H16O3/c1-10(2)4-7-12-13(17-3)8-5-11-6-9-14(16)18-15(11)12/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | MBRLOUHOWLUMFF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Angelica pubescens (ncbitaxon:312530) | - | PubMed (21627108) | |
| Peucedanum ostruthium (ncbitaxon:1000424) | |||
| rhizome (BTO:0001181) | PubMed (21627108) | Dichloromethane extract of dried, powdered roots and rhizomes | |
| root (BTO:0001188) | PubMed (21627108) | Dichloromethane extract of dried, powdered roots and rhizomes |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| osthole (CHEBI:69832) has role metabolite (CHEBI:25212) |
| osthole (CHEBI:69832) is a botanical anti-fungal agent (CHEBI:86494) |
| osthole (CHEBI:69832) is a coumarins (CHEBI:23403) |
| Synonyms | Source |
|---|---|
| 2H-1-Benzopyran-2-one, 7-methoxy-8-(3-methyl-2-butenyl)- | ChEBI |
| Coumarin, 7-methoxy-8-(3-methyl-2-butenyl)- | ChEBI |
| Citations |
|---|