EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:69832 - osthole
| Formula | C15H16O3 |
| Net Charge | 0 |
| Average Mass | 244.290 |
| Monoisotopic Mass | 244.10994 |
| SMILES | COc1ccc2ccc(=O)oc2c1CC=C(C)C |
| InChI | InChI=1S/C15H16O3/c1-10(2)4-7-12-13(17-3)8-5-11-6-9-14(16)18-15(11)12/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | MBRLOUHOWLUMFF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Angelica pubescens (ncbitaxon:312530) | - | PubMed (21627108) | |
| Peucedanum ostruthium (ncbitaxon:1000424) | |||
| rhizome (BTO:0001181) | PubMed (21627108) | Dichloromethane extract of dried, powdered roots and rhizomes | |
| root (BTO:0001188) | PubMed (21627108) | Dichloromethane extract of dried, powdered roots and rhizomes |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| osthole (CHEBI:69832) has role metabolite (CHEBI:25212) |
| osthole (CHEBI:69832) is a botanical anti-fungal agent (CHEBI:86494) |
| osthole (CHEBI:69832) is a coumarins (CHEBI:23403) |
| Synonyms | Source |
|---|---|
| 2H-1-Benzopyran-2-one, 7-methoxy-8-(3-methyl-2-butenyl)- | ChEBI |
| Coumarin, 7-methoxy-8-(3-methyl-2-butenyl)- | ChEBI |
| Citations |
|---|