EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O7 |
| Net Charge | 0 |
| Average Mass | 386.400 |
| Monoisotopic Mass | 386.13655 |
| SMILES | C/C=C(/C)C(=O)O[C@H](COc1c2ccoc2cc2oc(=O)ccc12)C(C)(C)O |
| InChI | InChI=1S/C21H22O7/c1-5-12(2)20(23)28-17(21(3,4)24)11-26-19-13-6-7-18(22)27-16(13)10-15-14(19)8-9-25-15/h5-10,17,24H,11H2,1-4H3/b12-5-/t17-/m1/s1 |
| InChIKey | WXULKGXQMWVWMP-OMLDUKLJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Peucedanum ostruthium (ncbitaxon:1000424) | |||
| rhizome (BTO:0001181) | PubMed (21627108) | Dichloromethane extract of dried, powdered roots and rhizomes | |
| root (BTO:0001188) | PubMed (21627108) | Dichloromethane extract of dried, powdered roots and rhizomes |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ostruthol (CHEBI:69831) has role metabolite (CHEBI:25212) |
| ostruthol (CHEBI:69831) is a furanocoumarin (CHEBI:24128) |
| Synonym | Source |
|---|---|
| (R-(Z))-(2-Hydroxy-2-methyl-1-(((7-oxo-7H-furo(3,2-g)(1)benzopyran-4-yl)oxy)methyl)propyl) 2-methyl-2-butenoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:642-08-0 | ChemIDplus |
| Citations |
|---|