EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O5 |
| Net Charge | 0 |
| Average Mass | 286.283 |
| Monoisotopic Mass | 286.08412 |
| SMILES | CC1(C)O[C@H]1COc1c2ccoc2cc2oc(=O)ccc12 |
| InChI | InChI=1S/C16H14O5/c1-16(2)13(21-16)8-19-15-9-3-4-14(17)20-12(9)7-11-10(15)5-6-18-11/h3-7,13H,8H2,1-2H3/t13-/m0/s1 |
| InChIKey | QTAGQHZOLRFCBU-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Peucedanum ostruthium (ncbitaxon:1000424) | |||
| root (BTO:0001188) | PubMed (21627108) | Dichloromethane extract of dried, powdered roots and rhizomes | |
| rhizome (BTO:0001181) | PubMed (21627108) | Dichloromethane extract of dried, powdered roots and rhizomes |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxypeucedanin (CHEBI:69830) has role plant metabolite (CHEBI:76924) |
| oxypeucedanin (CHEBI:69830) is a epoxide (CHEBI:32955) |
| oxypeucedanin (CHEBI:69830) is a furanocoumarin (CHEBI:24128) |
| oxypeucedanin (CHEBI:69830) is a lactone (CHEBI:25000) |
| IUPAC Name |
|---|
| 4-{[(2S)-3,3-dimethyloxiran-2-yl]methoxy}-7H-furo[3,2-g][1]benzopyran-7-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8561323 | Reaxys |
| CAS:26091-73-6 | KEGG COMPOUND |
| CAS:26091-73-6 | ChemIDplus |
| Citations |
|---|