EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O6 |
| Net Charge | 0 |
| Average Mass | 304.298 |
| Monoisotopic Mass | 304.09469 |
| SMILES | CC(C)(O)[C@H](O)COc1c2ccoc2cc2oc(=O)ccc12 |
| InChI | InChI=1S/C16H16O6/c1-16(2,19)13(17)8-21-15-9-3-4-14(18)22-12(9)7-11-10(15)5-6-20-11/h3-7,13,17,19H,8H2,1-2H3/t13-/m1/s1 |
| InChIKey | PEWFWDOPJISUOK-CYBMUJFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus hystrix (ncbitaxon:170989) | exocarp (BTO:0000733) | PubMed (20964319) | The hexane extract of dried and ground fruit peels |
| Peucedanum ostruthium (ncbitaxon:1000424) | |||
| rhizome (BTO:0001181) | PubMed (21627108) | Dichloromethane extract of dried, powdered roots and rhizomes | |
| root (BTO:0001188) | PubMed (21627108) | Dichloromethane extract of dried, powdered roots and rhizomes |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxypeucedanin hydrate (CHEBI:69829) has role metabolite (CHEBI:25212) |
| oxypeucedanin hydrate (CHEBI:69829) is a furanocoumarin (CHEBI:24128) |
| Synonyms | Source |
|---|---|
| 7H-Furo(3,2-g)(1)benzopyran-7-one, 4-(2,3-dihydroxy-3-methylbutoxy)-, (R)- | ChEBI |
| 7H-Furo(3,2-g)(1)benzopyran-7-one, 4-(2,3-dihydroxy-3-methylbutoxy)-, (R)-(+)- | ChEBI |
| Hydroxypeucedanin hydrate | ChEBI |
| Prangolarin hydrate | ChEBI |
| Prawgol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:2643-85-8 | ChemIDplus |
| Citations |
|---|