EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O4 |
| Net Charge | 0 |
| Average Mass | 330.424 |
| Monoisotopic Mass | 330.18311 |
| SMILES | [H][C@]12O[C@]13OC(=O)C(C)=C3[C@@]1([H])O[C@]13CC[C@]1([H])C(C)(C)CCC[C@@]1(C)[C@]23[H] |
| InChI | InChI=1S/C20H26O4/c1-10-12-14-19(22-14)9-6-11-17(2,3)7-5-8-18(11,4)13(19)15-20(12,23-15)24-16(10)21/h11,13-15H,5-9H2,1-4H3/t11-,13+,14-,15-,18-,19+,20-/m1/s1 |
| InChIKey | SOVOCMGDFRGRKF-MCDHERAVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia fischeriana (ncbitaxon:1035560) | whole plant (BTO:0001461) | PubMed (21534540) | 90% EtOH extract of dried and powdered plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jolkinolide B (CHEBI:69827) has role metabolite (CHEBI:25212) |
| jolkinolide B (CHEBI:69827) is a diterpene lactone (CHEBI:49193) |
| Synonym | Source |
|---|---|
| (4aR,6aS,7aR,10aR,11aR,11bR,11cR)-4,4,8,11c-tetramethyl-1,2,3,4,4a,5,6,11a,11b,11c-decahydrobisoxireno[3,4:1,10a]phenanthro[3,2-b]furan-9(7ah)-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:37905-08-1 | ChemIDplus |
| Citations |
|---|