EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | [H][C@@]12C[C@@]3([H])C(=C)C[C@]1(CC[C@]1([H])C(C)(C)C(=O)CC[C@@]21C)C(=O)[C@H]3O |
| InChI | InChI=1S/C20H28O3/c1-11-10-20-8-5-13-18(2,3)15(21)6-7-19(13,4)14(20)9-12(11)16(22)17(20)23/h12-14,16,22H,1,5-10H2,2-4H3/t12-,13+,14-,16-,19+,20-/m0/s1 |
| InChIKey | UQKJSKXVMBIKGF-KIINSAQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia fischeriana (ncbitaxon:1035560) | whole plant (BTO:0001461) | PubMed (21534540) | 90% EtOH extract of dried and powdered plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-13S-hydroxy-16-atisene-3,14-dione (CHEBI:69824) has parent hydride atisane (CHEBI:36471) |
| ent-13S-hydroxy-16-atisene-3,14-dione (CHEBI:69824) has role metabolite (CHEBI:25212) |
| ent-13S-hydroxy-16-atisene-3,14-dione (CHEBI:69824) is a diterpenoid (CHEBI:23849) |
| Synonym | Source |
|---|---|
| (5beta,8alpha,9beta,10alpha,12alpha,13S)-13-Hydroxyatis-16-ene-3,14-dione | ChEBI |
| Citations |
|---|