EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32O9 |
| Net Charge | 0 |
| Average Mass | 524.566 |
| Monoisotopic Mass | 524.20463 |
| SMILES | [H][C@]12[C@]3(C)CCCC(C)(C)[C@@]3([H])CC[C@]13OC(=O)[C@]2(O)C12Oc4cc(OC)c(C(C)=O)c(O)c4C=C1C(=O)O[C@]23[H] |
| InChI | InChI=1S/C29H32O9/c1-13(30)19-17(35-5)12-16-14(20(19)31)11-15-21(32)36-23-27-10-7-18-25(2,3)8-6-9-26(18,4)22(27)28(34,24(33)38-27)29(15,23)37-16/h11-12,18,22-23,31,34H,6-10H2,1-5H3/t18-,22+,23+,26-,27+,28+,29?/m1/s1 |
| InChIKey | XMCKQXKJWRGZMH-YTUCCQTESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia fischeriana (ncbitaxon:1035560) | whole plant (BTO:0001461) | PubMed (21534540) | 90% EtOH extract of dried and powdered plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| langduin D (CHEBI:69823) has role metabolite (CHEBI:25212) |
| langduin D (CHEBI:69823) is a terpene lactone (CHEBI:37668) |
| Citations |
|---|