EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O5 |
| Net Charge | 0 |
| Average Mass | 348.439 |
| Monoisotopic Mass | 348.19367 |
| SMILES | [H][C@@]12C=C(C)C(=O)[C@@]1(O)CC(CO)=C[C@@]1([H])[C@H](C(C)C)C(=O)C[C@@H](C)[C@]21O |
| InChI | InChI=1S/C20H28O5/c1-10(2)17-14-7-13(9-21)8-19(24)16(5-11(3)18(19)23)20(14,25)12(4)6-15(17)22/h5,7,10,12,14,16-17,21,24-25H,6,8-9H2,1-4H3/t12-,14+,16-,17+,19-,20-/m1/s1 |
| InChIKey | BGNXBPPAQJJLSA-QEUCBDMBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia fischeriana (ncbitaxon:1035560) | whole plant (BTO:0001461) | PubMed (21534540) | 90% EtOH extract of dried and powdered plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| langduin A (CHEBI:69822) has role metabolite (CHEBI:25212) |
| langduin A (CHEBI:69822) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|