EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H44O15 |
| Net Charge | 0 |
| Average Mass | 704.722 |
| Monoisotopic Mass | 704.26802 |
| SMILES | [H][C@@]12C=C(C)C(=O)[C@@]1(O)CC(CO[C@@H]1O[C@H](COC(=O)c3cc(O)c(O)c(O)c3)[C@@H](O)[C@H](O)[C@H]1O)=C[C@]1([H])[C@]2(O)[C@H](C)C[C@@]2(OC(C)=O)C(C)(C)[C@@]12[H] |
| InChI | InChI=1S/C35H44O15/c1-14-6-23-33(45,29(14)43)11-17(7-19-28-32(4,5)34(28,50-16(3)36)10-15(2)35(19,23)46)12-48-31-27(42)26(41)25(40)22(49-31)13-47-30(44)18-8-20(37)24(39)21(38)9-18/h6-9,15,19,22-23,25-28,31,37-42,45-46H,10-13H2,1-5H3/t15-,19+,22-,23-,25-,26+,27-,28-,31-,33-,34+,35-/m1/s1 |
| InChIKey | HILKKSGKHWLFAN-QWOHJRRRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia fischeriana (ncbitaxon:1035560) | whole plant (BTO:0001461) | PubMed (21534540) | 90% EtOH extract of dried and powdered plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fischeroside B (CHEBI:69816) has role metabolite (CHEBI:25212) |
| fischeroside B (CHEBI:69816) is a diterpene glycoside (CHEBI:71939) |
| Synonym | Source |
|---|---|
| Prostratin 20-O-(6'-galloyl)-beta-D-glucopyranoside | ChEBI |
| Citations |
|---|