EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40O11 |
| Net Charge | 0 |
| Average Mass | 552.617 |
| Monoisotopic Mass | 552.25706 |
| SMILES | [H][C@@]12C=C(C)C(=O)[C@@]1(O)CC(CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)=C[C@]1([H])[C@]2(O)[C@H](C)C[C@@]2(OC(C)=O)C(C)(C)[C@@]12[H] |
| InChI | InChI=1S/C28H40O11/c1-12-6-18-26(35,23(12)34)9-15(11-37-24-21(33)20(32)19(31)17(10-29)38-24)7-16-22-25(4,5)27(22,39-14(3)30)8-13(2)28(16,18)36/h6-7,13,16-22,24,29,31-33,35-36H,8-11H2,1-5H3/t13-,16+,17-,18-,19-,20+,21-,22-,24-,26-,27+,28-/m1/s1 |
| InChIKey | JMDGBSYRPFFZBO-WHDWRCRCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia fischeriana (ncbitaxon:1035560) | whole plant (BTO:0001461) | PubMed (21534540) | 90% EtOH extract of dried and powdered plant |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fischeroside A (CHEBI:69815) has role metabolite (CHEBI:25212) |
| fischeroside A (CHEBI:69815) is a diterpene glycoside (CHEBI:71939) |
| Synonym | Source |
|---|---|
| Prostratin 20-O-beta-D-glucopyranoside | ChEBI |
| Citations |
|---|