EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13N3O |
| Net Charge | 0 |
| Average Mass | 251.289 |
| Monoisotopic Mass | 251.10586 |
| SMILES | CNc1ccc(-c2nc(=O)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C15H13N3O/c1-16-11-8-6-10(7-9-11)14-17-13-5-3-2-4-12(13)15(19)18-14/h2-9,16H,1H3,(H,17,18,19) |
| InChIKey | HPAJBWPBFGTJFP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | mycelium (BTO:0001436) | PubMed (21639131) | freeze-dried mycelial extarct Strain: A496 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[4'-(Methylamino)phenyl]quinazolin-4(3H)-one (CHEBI:69813) has role metabolite (CHEBI:25212) |
| 2-[4'-(Methylamino)phenyl]quinazolin-4(3H)-one (CHEBI:69813) is a quinazolines (CHEBI:38530) |
| Citations |
|---|