EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H45NO12 |
| Net Charge | 0 |
| Average Mass | 683.751 |
| Monoisotopic Mass | 683.29418 |
| SMILES | CC(=O)O[C@H]1[C@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)/C=C/C=C\C(=O)NC2=C(C)C(=O)c3c(c(O)c(C)c4c3[C@H](O)[C@](C)(O/C=C/[C@H](O)[C@H]1C)O4)C2=O |
| InChI | InChI=1S/C36H45NO12/c1-15-11-9-10-12-23(40)37-27-17(3)30(43)24-25(32(27)45)31(44)20(6)34-26(24)35(46)36(8,49-34)47-14-13-22(39)16(2)33(48-21(7)38)19(5)29(42)18(4)28(15)41/h9-16,18-19,22,28-29,33,35,39,41-42,44,46H,1-8H3,(H,37,40)/b11-9+,12-10-,14-13+/t15-,16+,18+,19+,22-,28-,29+,33+,35-,36+/m0/s1 |
| InChIKey | QWIHJIQXNOWSHR-MIWIPQMRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces species C34 (ncbitaxon:531950) | - | PubMed (21553813) | Methanolic extract of streptomyces sp. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chaxamycin D, rel- (CHEBI:69812) has role metabolite (CHEBI:25212) |
| Chaxamycin D, rel- (CHEBI:69812) is a azamacrocycle (CHEBI:52898) |
| Chaxamycin D, rel- (CHEBI:69812) is a lactam (CHEBI:24995) |
| Citations |
|---|