EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H45NO9 |
| Net Charge | 0 |
| Average Mass | 623.743 |
| Monoisotopic Mass | 623.30943 |
| SMILES | CC1=C2NC(=O)/C=C\C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)/C=C(\C)C(=O)c3c(O)c(C)cc(c3C1=O)C2=O |
| InChI | InChI=1S/C35H45NO9/c1-15-11-9-10-12-24(37)36-27-19(5)34(44)25-23(35(27)45)14-18(4)31(41)26(25)30(40)17(3)13-16(2)29(39)21(7)33(43)22(8)32(42)20(6)28(15)38/h9-16,20-22,28-29,32-33,38-39,41-43H,1-8H3,(H,36,37)/b11-9+,12-10-,17-13+/t15-,16-,20+,21+,22+,28-,29-,32+,33+/m0/s1 |
| InChIKey | YIELQFCSZNNHLS-AIGVRGBASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces species C34 (ncbitaxon:531950) | - | PubMed (21553813) | Methanolic extract of streptomyces sp. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chaxamycin B, rel- (CHEBI:69810) has role metabolite (CHEBI:25212) |
| Chaxamycin B, rel- (CHEBI:69810) is a azamacrocycle (CHEBI:52898) |
| Chaxamycin B, rel- (CHEBI:69810) is a lactam (CHEBI:24995) |
| Citations |
|---|