EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H45NO10 |
| Net Charge | 0 |
| Average Mass | 639.742 |
| Monoisotopic Mass | 639.30435 |
| SMILES | CC1=C2NC(=O)/C=C\C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)/C=C(\C)C(=O)c3c(O)c(C)c(O)c(c3C1=O)C2=O |
| InChI | InChI=1S/C35H45NO10/c1-14-11-9-10-12-22(37)36-26-17(4)32(43)23-24(33(44)21(8)34(45)25(23)35(26)46)29(40)16(3)13-15(2)28(39)19(6)31(42)20(7)30(41)18(5)27(14)38/h9-15,18-20,27-28,30-31,38-39,41-42,44-45H,1-8H3,(H,36,37)/b11-9+,12-10-,16-13+/t14-,15-,18+,19+,20+,27-,28-,30+,31+/m0/s1 |
| InChIKey | OWRAZHDHNJAEKU-NMCWGSMOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces species C34 (ncbitaxon:531950) | - | PubMed (21553813) | Methanolic extract of streptomyces sp. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chaxamycin A, rel- (CHEBI:69809) has role metabolite (CHEBI:25212) |
| Chaxamycin A, rel- (CHEBI:69809) is a azamacrocycle (CHEBI:52898) |
| Chaxamycin A, rel- (CHEBI:69809) is a lactam (CHEBI:24995) |
| Citations |
|---|