EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H54O23 |
| Net Charge | 0 |
| Average Mass | 902.849 |
| Monoisotopic Mass | 902.30559 |
| SMILES | [H]C1[C@@H](O)[C@@H](O)CO[C@@]1([H])O[C@H]1[C@H](OCCc2ccc(O)c(O)c2)O[C@H](CO[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)[C@@H](OC(=O)/C=C/c2ccc(O)c(OC)c2)[C@@H]1O[C@]1([H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/4,4,3/[a2122h-1b_1-5_1*OCC(CCCCCC$5/8)O(/7)O_4*OCC=^EC(CCCCCC$6/9)O(/8)OC/3=O][ad11h-1a_1-5][a2122h-1b_1-5][a212h-1b_1-5]/1-2-3-4/a2-b1_a3-c1_a6-d1 |
| InChI | InChI=1S/C40H54O23/c1-54-25-11-17(3-6-20(25)43)4-7-28(48)61-35-27(16-58-38-33(52)30(49)24(47)15-57-38)60-40(55-9-8-18-2-5-19(42)21(44)10-18)37(62-29-12-22(45)23(46)14-56-29)36(35)63-39-34(53)32(51)31(50)26(13-41)59-39/h2-7,10-11,22-24,26-27,29-47,49-53H,8-9,12-16H2,1H3/b7-4+/t22-,23+,24-,26-,27-,29+,30+,31-,32+,33-,34-,35-,36+,37-,38+,39+,40-/m1/s1 |
| InChIKey | IPIDJIFORCRBPN-ODPUUKIVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Veronica lavaudiana (ncbitaxon:124267) | - | PubMed (21568305) | MeOH extract of plant material |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Helioside C (CHEBI:69807) has role metabolite (CHEBI:25212) |
| Helioside C (CHEBI:69807) is a oligosaccharide (CHEBI:50699) |
| Citations |
|---|