EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H44O19 |
| Net Charge | 0 |
| Average Mass | 756.707 |
| Monoisotopic Mass | 756.24768 |
| SMILES | [H]C1[C@@H](O)[C@@H](O)CO[C@@]1([H])O[C@H]1[C@H](OCCc2ccc(O)c(O)c2)O[C@H](CO)[C@@H](OC(=O)/C=C/c2ccc(O)c(O)c2)[C@@H]1O[C@]1([H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/3,3,2/[a2122h-1b_1-5_1*OCC(CCCCCC$5/8)O(/7)O_4*OCC=^EC(CCCCCC$6/9)O(/8)O/3=O][ad11h-1a_1-5][a2122h-1b_1-5]/1-2-3/a2-b1_a3-c1 |
| InChI | InChI=1S/C34H44O19/c35-12-23-27(44)28(45)29(46)33(49-23)53-31-30(51-25(43)6-3-15-1-4-17(37)19(39)9-15)24(13-36)50-34(32(31)52-26-11-21(41)22(42)14-48-26)47-8-7-16-2-5-18(38)20(40)10-16/h1-6,9-10,21-24,26-42,44-46H,7-8,11-14H2/b6-3+/t21-,22+,23-,24-,26+,27-,28+,29-,30-,31+,32-,33+,34-/m1/s1 |
| InChIKey | IFKNAQLEQACEOH-YNQIJJLYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Veronica lavaudiana (ncbitaxon:124267) | - | PubMed (21568305) | MeOH extract of plant material |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aragoside (CHEBI:69804) has role metabolite (CHEBI:25212) |
| aragoside (CHEBI:69804) is a oligosaccharide (CHEBI:50699) |
| Citations |
|---|