EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O13 |
| Net Charge | 0 |
| Average Mass | 524.475 |
| Monoisotopic Mass | 524.15299 |
| SMILES | [H][C@@]1(O[C@@H]2OC=C[C@@]3([H])[C@H](O)[C@]4([H])O[C@]4(CO)[C@@]23[H])O[C@H](COC(=O)/C=C/c2ccc(O)c(O)c2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H28O13/c25-9-24-16-11(17(29)21(24)37-24)5-6-33-22(16)36-23-20(32)19(31)18(30)14(35-23)8-34-15(28)4-2-10-1-3-12(26)13(27)7-10/h1-7,11,14,16-23,25-27,29-32H,8-9H2/b4-2+/t11-,14-,16-,17+,18-,19+,20-,21+,22+,23+,24-/m1/s1 |
| InChIKey | KNJZBAUYPCGTFR-UTOUBEBWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Veronica lavaudiana (ncbitaxon:124267) | - | PubMed (21568305) | MeOH extract of plant material |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6'-O-Caffeoylcatalpol (CHEBI:69802) has role metabolite (CHEBI:25212) |
| 6'-O-Caffeoylcatalpol (CHEBI:69802) is a hydroxycinnamic acid (CHEBI:24689) |
| Citations |
|---|