EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23N7O7 |
| Net Charge | 0 |
| Average Mass | 473.446 |
| Monoisotopic Mass | 473.16590 |
| SMILES | [H]C(=O)N(CC1CNc2nc(N)nc(=O)c2N1)c1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C20H23N7O7/c21-20-25-16-15(18(32)26-20)23-11(7-22-16)8-27(9-28)12-3-1-10(2-4-12)17(31)24-13(19(33)34)5-6-14(29)30/h1-4,9,11,13,23H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H4,21,22,25,26,32)/t11?,13-/m0/s1 |
| InChIKey | AUFGTPPARQZWDO-YUZLPWPTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Trypanosoma brucei (ncbitaxon:5691) | - | MetaboLights (MTBLS49) | From MetaboLights |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-formyltetrahydrofolic acid (CHEBI:15637) has role Escherichia coli metabolite (CHEBI:76971) |
| 10-formyltetrahydrofolic acid (CHEBI:15637) has role mouse metabolite (CHEBI:75771) |
| 10-formyltetrahydrofolic acid (CHEBI:15637) is a formyltetrahydrofolic acid (CHEBI:24099) |
| 10-formyltetrahydrofolic acid (CHEBI:15637) is conjugate acid of 10-formyltetrahydrofolate(2−) (CHEBI:57454) |
| Incoming Relation(s) |
| 10-formyltetrahydrofolyl polyglutamate macromolecule (CHEBI:28010) has functional parent 10-formyltetrahydrofolic acid (CHEBI:15637) |
| (6R)-10-formyltetrahydrofolic acid (CHEBI:195364) is a 10-formyltetrahydrofolic acid (CHEBI:15637) |
| (6S)-10-formyltetrahydrofolic acid (CHEBI:195365) is a 10-formyltetrahydrofolic acid (CHEBI:15637) |
| 10-formyltetrahydrofolate(2−) (CHEBI:57454) is conjugate base of 10-formyltetrahydrofolic acid (CHEBI:15637) |
| IUPAC Name |
|---|
| N-(4-{[(2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl](formyl)amino}benzoyl)-L-glutamic acid |
| Synonyms | Source |
|---|---|
| 10-formyl-5,6,7,8-tetrahydrofolic acid | ChEBI |
| 10-formyl-(6RS)-tetrahydrofolic acid | ChEBI |
| 10-Formyltetrahydrofolate | KEGG COMPOUND |
| 10-formyltetrahydropteroylglutamic acid | ChemIDplus |
| 10-formyl-THF | KEGG COMPOUND |
| 10-FTHF | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00007251 | KNApSAcK |
| C00234 | KEGG COMPOUND |
| FDB022345 | FooDB |
| HMDB0000972 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:101559 | Beilstein |
| CAS:2800-34-2 | ChemIDplus |
| CAS:2800-34-2 | KEGG COMPOUND |
| Citations |
|---|