EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N7O7 |
| Net Charge | -2 |
| Average Mass | 471.430 |
| Monoisotopic Mass | 471.15134 |
| SMILES | [H]C(=O)N(CC1CNc2nc(N)nc(=O)c2N1)c1ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])cc1 |
| InChI | InChI=1S/C20H23N7O7/c21-20-25-16-15(18(32)26-20)23-11(7-22-16)8-27(9-28)12-3-1-10(2-4-12)17(31)24-13(19(33)34)5-6-14(29)30/h1-4,9,11,13,23H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H4,21,22,25,26,32)/p-2/t11?,13-/m0/s1 |
| InChIKey | AUFGTPPARQZWDO-YUZLPWPTSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-formyltetrahydrofolate(2−) (CHEBI:57454) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 10-formyltetrahydrofolate(2−) (CHEBI:57454) has role human metabolite (CHEBI:77746) |
| 10-formyltetrahydrofolate(2−) (CHEBI:57454) is a dicarboxylic acid dianion (CHEBI:28965) |
| 10-formyltetrahydrofolate(2−) (CHEBI:57454) is conjugate base of 10-formyltetrahydrofolic acid (CHEBI:15637) |
| Incoming Relation(s) |
| (6R)-10-formyltetrahydrofolate(2−) (CHEBI:195366) is a 10-formyltetrahydrofolate(2−) (CHEBI:57454) |
| (6S)-10-formyltetrahydrofolate(2−) (CHEBI:195367) is a 10-formyltetrahydrofolate(2−) (CHEBI:57454) |
| 10-formyltetrahydrofolic acid (CHEBI:15637) is conjugate acid of 10-formyltetrahydrofolate(2−) (CHEBI:57454) |
| IUPAC Name |
|---|
| (2S)-2-(4-{[(2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl](formyl)amino}benzamido)pentanedioate |
| Synonyms | Source |
|---|---|
| 10-formyltetrahydrofolate | ChEBI |
| 10-formyltetrahydrofolate dianion | ChEBI |
| 10-HCO-H4folate | ChEBI |
| UniProt Name | Source |
|---|---|
| 10-formyltetrahydrofolate | UniProt |